C20H24O3 — CID 88904866
methoxymethyl 4-[(6Z,7Z)-6,7-di(ethylidene)naphthalen-1-yl]butanoate (PubChem CID 88904866) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is methoxymethyl 4-[(6Z,7Z)-6,7-di(ethylidene)naphthalen-1-yl]butanoate.
| Compound Name | methoxymethyl 4-[(6Z,7Z)-6,7-di(ethylidene)naphthalen-1-yl]butanoate |
|---|---|
| PubChem CID | 88904866 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | methoxymethyl 4-[(6Z,7Z)-6,7-di(ethylidene)naphthalen-1-yl]butanoate |
| SMILES | C/C=c1/cc2cccc(CCCC(=O)OCOC)c2c/c1=C/C |
| InChI | InChI=1S/C20H24O3/c1-4-15-12-18-10-6-8-17(19(18)13-16(15)5-2)9-7-11-20(21)23-14-22-3/h4-6,8,10,12-13H,7,9,11,14H2,1-3H3/b15-4-,16-5- |
| InChIKey | ICJNQOLVJGYFQN-MZRALVGYSA-N |
| XLogP | 2.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|