C20H30O3 — CID 88906640
2,2,4,4-tetramethylhex-5-ynoyl 2,2,4,4-tetramethylhex-5-ynoate (PubChem CID 88906640) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2,2,4,4-tetramethylhex-5-ynoyl 2,2,4,4-tetramethylhex-5-ynoate.
| Compound Name | 2,2,4,4-tetramethylhex-5-ynoyl 2,2,4,4-tetramethylhex-5-ynoate |
|---|---|
| PubChem CID | 88906640 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2,2,4,4-tetramethylhex-5-ynoyl 2,2,4,4-tetramethylhex-5-ynoate |
| SMILES | C#CC(C)(C)CC(C)(C)C(=O)OC(=O)C(C)(C)CC(C)(C)C#C |
| InChI | InChI=1S/C20H30O3/c1-11-17(3,4)13-19(7,8)15(21)23-16(22)20(9,10)14-18(5,6)12-2/h1-2H,13-14H2,3-10H3 |
| InChIKey | UEWJGAPXMRWMBB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|