C13H23NO — CID 167115818
2,2,4,4-tetramethyl-N-propylhex-5-ynamide (PubChem CID 167115818) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-N-propylhex-5-ynamide.
| Compound Name | 2,2,4,4-tetramethyl-N-propylhex-5-ynamide |
|---|---|
| PubChem CID | 167115818 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2,2,4,4-tetramethyl-N-propylhex-5-ynamide |
| SMILES | C#CC(C)(C)CC(C)(C)C(=O)NCCC |
| InChI | InChI=1S/C13H23NO/c1-7-9-14-11(15)13(5,6)10-12(3,4)8-2/h2H,7,9-10H2,1,3-6H3,(H,14,15) |
| InChIKey | LSQJRMZJQDHKKC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|