C22H31NO14S — CID 88907197
methyl 4-acetylsulfanyl-3-[(3,4,5,6-tetraacetyloxyoxan-2-yl)methoxycarbonylamino]butanoate (PubChem CID 88907197) has the molecular formula C22H31NO14S and a molecular weight of 565.55 g/mol. Its IUPAC name is methyl 4-acetylsulfanyl-3-[(3,4,5,6-tetraacetyloxyoxan-2-yl)methoxycarbonylamino]butanoate.
| Compound Name | methyl 4-acetylsulfanyl-3-[(3,4,5,6-tetraacetyloxyoxan-2-yl)methoxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 88907197 |
| Molecular Formula | C22H31NO14S |
| Molecular Weight | 565.55 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | methyl 4-acetylsulfanyl-3-[(3,4,5,6-tetraacetyloxyoxan-2-yl)methoxycarbonylamino]butanoate |
| SMILES | COC(=O)CC(CSC(C)=O)NC(=O)OCC1OC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C22H31NO14S/c1-10(24)33-18-16(8-32-22(30)23-15(7-17(29)31-6)9-38-14(5)28)37-21(36-13(4)27)20(35-12(3)26)19(18)34-11(2)25/h15-16,18-21H,7-9H2,1-6H3,(H,23,30) |
| InChIKey | LKOPJMQOKYBSFV-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 196.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.55 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|