C19H16ClNO4S — CID 88908101
N-[4-(4-chlorophenyl)-3-(hydroperoxymethyl)thiophen-2-yl]-4-methoxybenzamide (PubChem CID 88908101) has the molecular formula C19H16ClNO4S and a molecular weight of 389.86 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-3-(hydroperoxymethyl)thiophen-2-yl]-4-methoxybenzamide.
| Compound Name | N-[4-(4-chlorophenyl)-3-(hydroperoxymethyl)thiophen-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 88908101 |
| Molecular Formula | C19H16ClNO4S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | N-[4-(4-chlorophenyl)-3-(hydroperoxymethyl)thiophen-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2scc(-c3ccc(Cl)cc3)c2COO)cc1 |
| InChI | InChI=1S/C19H16ClNO4S/c1-24-15-8-4-13(5-9-15)18(22)21-19-16(10-25-23)17(11-26-19)12-2-6-14(20)7-3-12/h2-9,11,23H,10H2,1H3,(H,21,22) |
| InChIKey | IWIGLTNOOAFIGI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|