About S-(2-methoxypropyl) methanethioate
S-(2-methoxypropyl) methanethioate (PubChem CID 88911488) has the molecular formula C5H10O2S
and a molecular weight of 134.20 g/mol. Its IUPAC name is S-(2-methoxypropyl) methanethioate.
Molecular Properties
| Compound Name | S-(2-methoxypropyl) methanethioate |
| PubChem CID | 88911488 |
| Molecular Formula | C5H10O2S |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | S-(2-methoxypropyl) methanethioate |
| SMILES | COC(C)CSC=O |
| InChI | InChI=1S/C5H10O2S/c1-5(7-2)3-8-4-6/h4-5H,3H2,1-2H3 |
| InChIKey | YVSZLOLWSXZTLI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-methoxypropyl) methanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-methoxypropyl) methanethioate?
The IUPAC name of S-(2-methoxypropyl) methanethioate (CID 88911488) is S-(2-methoxypropyl) methanethioate.
What is the SMILES notation for S-(2-methoxypropyl) methanethioate?
The canonical SMILES for S-(2-methoxypropyl) methanethioate is COC(C)CSC=O.
What is the InChIKey of S-(2-methoxypropyl) methanethioate?
The InChIKey is YVSZLOLWSXZTLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2S/c1-5(7-2)3-8-4-6/h4-5H,3H2,1-2H3.
What are the key properties of S-(2-methoxypropyl) methanethioate?
S-(2-methoxypropyl) methanethioate has a molecular weight of 134.20 g/mol, XLogP of 0.94, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-methoxypropyl) methanethioate is sourced from PubChem (CID 88911488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).