C36H44N6O6 — CID 88912691
1-N,2-N,3-N-tris[2-(4-formyl-N-methylanilino)ethyl]propane-1,2,3-tricarboxamide (PubChem CID 88912691) has the molecular formula C36H44N6O6 and a molecular weight of 656.78 g/mol. Its IUPAC name is 1-N,2-N,3-N-tris[2-(4-formyl-N-methylanilino)ethyl]propane-1,2,3-tricarboxamide.
| Compound Name | 1-N,2-N,3-N-tris[2-(4-formyl-N-methylanilino)ethyl]propane-1,2,3-tricarboxamide |
|---|---|
| PubChem CID | 88912691 |
| Molecular Formula | C36H44N6O6 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.33 |
| IUPAC Name | 1-N,2-N,3-N-tris[2-(4-formyl-N-methylanilino)ethyl]propane-1,2,3-tricarboxamide |
| SMILES | CN(CCNC(=O)CC(CC(=O)NCCN(C)c1ccc(C=O)cc1)C(=O)NCCN(C)c1ccc(C=O)cc1)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C36H44N6O6/c1-40(31-10-4-27(24-43)5-11-31)19-16-37-34(46)22-30(36(48)39-18-21-42(3)33-14-8-29(26-45)9-15-33)23-35(47)38-17-20-41(2)32-12-6-28(25-44)7-13-32/h4-15,24-26,30H,16-23H2,1-3H3,(H,37,46)(H,38,47)(H,39,48) |
| InChIKey | SXWBMSDVYYLYMR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|