C10H12BrNO2 — CID 88913217
(E)-3-(6-bromo-3-methylcyclohexa-1,5-dien-1-yl)-N-hydroxyprop-2-enamide (PubChem CID 88913217) has the molecular formula C10H12BrNO2 and a molecular weight of 258.12 g/mol. Its IUPAC name is (E)-3-(6-bromo-3-methylcyclohexa-1,5-dien-1-yl)-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-(6-bromo-3-methylcyclohexa-1,5-dien-1-yl)-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 88913217 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | (E)-3-(6-bromo-3-methylcyclohexa-1,5-dien-1-yl)-N-hydroxyprop-2-enamide |
| SMILES | CC1C=C(/C=C/C(=O)NO)C(Br)=CC1 |
| InChI | InChI=1S/C10H12BrNO2/c1-7-2-4-9(11)8(6-7)3-5-10(13)12-14/h3-7,14H,2H2,1H3,(H,12,13)/b5-3+ |
| InChIKey | FKTXKTHFMOTEQV-HWKANZROSA-N |
| XLogP | 2.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|