C23H26N4O3 — CID 88913882
2-[18-(cyanomethyl)-8-methyl-2,5,15-trioxa-12,18-diazatricyclo[17.4.0.06,11]tricosa-1(23),6(11),7,9,19,21-hexaen-12-yl]acetonitrile (PubChem CID 88913882) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 2-[18-(cyanomethyl)-8-methyl-2,5,15-trioxa-12,18-diazatricyclo[17.4.0.06,11]tricosa-1(23),6(11),7,9,19,21-hexaen-12-yl]acetonitrile.
| Compound Name | 2-[18-(cyanomethyl)-8-methyl-2,5,15-trioxa-12,18-diazatricyclo[17.4.0.06,11]tricosa-1(23),6(11),7,9,19,21-hexaen-12-yl]acetonitrile |
|---|---|
| PubChem CID | 88913882 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 2-[18-(cyanomethyl)-8-methyl-2,5,15-trioxa-12,18-diazatricyclo[17.4.0.06,11]tricosa-1(23),6(11),7,9,19,21-hexaen-12-yl]acetonitrile |
| SMILES | Cc1ccc2c(c1)OCCOc1ccccc1N(CC#N)CCOCCN2CC#N |
| InChI | InChI=1S/C23H26N4O3/c1-19-6-7-21-23(18-19)30-17-16-29-22-5-3-2-4-20(22)26(10-8-24)12-14-28-15-13-27(21)11-9-25/h2-7,18H,10-17H2,1H3 |
| InChIKey | XEMCTBQABGQBLE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|