C27H31N3O6S — CID 88915964
13-cyclohexyl-3-methoxy-6-(methylperoxymethyl)-N-sulfamoyl-7H-indolo[2,1-a][2]benzazepine-10-carboxamide (PubChem CID 88915964) has the molecular formula C27H31N3O6S and a molecular weight of 525.63 g/mol. Its IUPAC name is 13-cyclohexyl-3-methoxy-6-(methylperoxymethyl)-N-sulfamoyl-7H-indolo[2,1-a][2]benzazepine-10-carboxamide.
| Compound Name | 13-cyclohexyl-3-methoxy-6-(methylperoxymethyl)-N-sulfamoyl-7H-indolo[2,1-a][2]benzazepine-10-carboxamide |
|---|---|
| PubChem CID | 88915964 |
| Molecular Formula | C27H31N3O6S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 13-cyclohexyl-3-methoxy-6-(methylperoxymethyl)-N-sulfamoyl-7H-indolo[2,1-a][2]benzazepine-10-carboxamide |
| SMILES | COOCC1=Cc2cc(OC)ccc2-c2c(C3CCCCC3)c3ccc(C(=O)NS(N)(=O)=O)cc3n2C1 |
| InChI | InChI=1S/C27H31N3O6S/c1-34-21-9-11-22-20(13-21)12-17(16-36-35-2)15-30-24-14-19(27(31)29-37(28,32)33)8-10-23(24)25(26(22)30)18-6-4-3-5-7-18/h8-14,18H,3-7,15-16H2,1-2H3,(H,29,31)(H2,28,32,33) |
| InChIKey | YBQUAHDWAUHWQY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|