C12H21N3 — CID 88916911
1-[(3E,5Z)-6-aminohepta-1,3,5-trien-4-yl]piperidin-4-amine (PubChem CID 88916911) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-[(3E,5Z)-6-aminohepta-1,3,5-trien-4-yl]piperidin-4-amine.
| Compound Name | 1-[(3E,5Z)-6-aminohepta-1,3,5-trien-4-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 88916911 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 1-[(3E,5Z)-6-aminohepta-1,3,5-trien-4-yl]piperidin-4-amine |
| SMILES | C=C/C=C(\C=C(\C)N)N1CCC(N)CC1 |
| InChI | InChI=1S/C12H21N3/c1-3-4-12(9-10(2)13)15-7-5-11(14)6-8-15/h3-4,9,11H,1,5-8,13-14H2,2H3/b10-9-,12-4+ |
| InChIKey | SSDNBHDHIPWLEP-MMQHMWHNSA-N |
| XLogP | 1.34 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|