C72H58N8 — CID 88918282
N-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6-diphenyl-N-[4-[4-[6-[4-[4-(N-phenylanilino)phenyl]phenyl]hexyl]phenyl]phenyl]-1,3,5-triazin-2-amine (PubChem CID 88918282) has the molecular formula C72H58N8 and a molecular weight of 1035.31 g/mol. Its IUPAC name is N-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6-diphenyl-N-[4-[4-[6-[4-[4-(N-phenylanilino)phenyl]phenyl]hexyl]phenyl]phenyl]-1,3,5-triazin-2-amine.
| Compound Name | N-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6-diphenyl-N-[4-[4-[6-[4-[4-(N-phenylanilino)phenyl]phenyl]hexyl]phenyl]phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 88918282 |
| Molecular Formula | C72H58N8 |
| Molecular Weight | 1035.31 g/mol |
| Exact Mass | 1034.48 |
| IUPAC Name | N-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6-diphenyl-N-[4-[4-[6-[4-[4-(N-phenylanilino)phenyl]phenyl]hexyl]phenyl]phenyl]-1,3,5-triazin-2-amine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(N(c3ccc(-c4ccc(CCCCCCc5ccc(-c6ccc(N(c7ccccc7)c7ccccc7)cc6)cc5)cc4)cc3)c3nc(-c4ccccc4)nc(-c4ccccc4)n3)n2)cc1 |
| InChI | InChI=1S/C72H58N8/c1(9-23-53-37-41-55(42-38-53)57-45-49-65(50-46-57)79(63-33-19-7-20-34-63)64-35-21-8-22-36-64)2-10-24-54-39-43-56(44-40-54)58-47-51-66(52-48-58)80(71-75-67(59-25-11-3-12-26-59)73-68(76-71)60-27-13-4-14-28-60)72-77-69(61-29-15-5-16-30-61)74-70(78-72)62-31-17-6-18-32-62/h3-8,11-22,25-52H,1-2,9-10,23-24H2 |
| InChIKey | CZWMSVLBIUBVBV-UHFFFAOYSA-N |
| XLogP | 18.34 |
| TPSA | 83.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.31 |
| LogP ≤ 5 | 18.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|