C46H44F6N12O5P+ — CID 88920061
bis[[2-cyclopropyl-6-(3-oxopropyl)-8-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-3,6-dihydropurin-9-yl]methoxy]-oxophosphanium (PubChem CID 88920061) has the molecular formula C46H44F6N12O5P+ and a molecular weight of 989.90 g/mol. Its IUPAC name is bis[[2-cyclopropyl-6-(3-oxopropyl)-8-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-3,6-dihydropurin-9-yl]methoxy]-oxophosphanium.
| Compound Name | bis[[2-cyclopropyl-6-(3-oxopropyl)-8-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-3,6-dihydropurin-9-yl]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 88920061 |
| Molecular Formula | C46H44F6N12O5P+ |
| Molecular Weight | 989.90 g/mol |
| Exact Mass | 989.32 |
| IUPAC Name | bis[[2-cyclopropyl-6-(3-oxopropyl)-8-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]-3,6-dihydropurin-9-yl]methoxy]-oxophosphanium |
| SMILES | O=CCCC1N=C(C2CC2)Nc2c1nc(-c1cnn(Cc3cccc(C(F)(F)F)c3)c1)n2CO[P+](=O)OCn1c(-c2cnn(Cc3cccc(C(F)(F)F)c3)c2)nc2c1NC(C1CC1)=NC2CCC=O |
| InChI | InChI=1S/C46H44F6N12O5P/c47-45(48,49)33-7-1-5-27(17-33)21-61-23-31(19-53-61)41-57-37-35(9-3-15-65)55-39(29-11-12-29)59-43(37)63(41)25-68-70(67)69-26-64-42(58-38-36(10-4-16-66)56-40(30-13-14-30)60-44(38)64)32-20-54-62(24-32)22-28-6-2-8-34(18-28)46(50,51)52/h1-2,5-8,15-20,23-24,29-30,35-36H,3-4,9-14,21-22,25-26H2,(H,55,59)(H,56,60)/q+1 |
| InChIKey | DKRSYCIHJCMKFO-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 189.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 989.90 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|