C22H24N3O2+ — CID 8892424
1-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]piperidin-1-ium-4-carboxamide (PubChem CID 8892424) has the molecular formula C22H24N3O2+ and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 8892424 |
| Molecular Formula | C22H24N3O2+ |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 1-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]piperidin-1-ium-4-carboxamide |
| SMILES | NC(=O)C1CC[NH+]([C@@H](C(=O)c2c[nH]c3ccccc23)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H23N3O2/c23-22(27)16-10-12-25(13-11-16)20(15-6-2-1-3-7-15)21(26)18-14-24-19-9-5-4-8-17(18)19/h1-9,14,16,20,24H,10-13H2,(H2,23,27)/p+1/t20-/m1/s1 |
| InChIKey | ZFYMQFSYVZYHMW-HXUWFJFHSA-O |
| XLogP | 1.87 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |