C24H24N5O+ — CID 8893705
(2S)-1-(1H-indol-3-yl)-2-phenyl-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)ethanone (PubChem CID 8893705) has the molecular formula C24H24N5O+ and a molecular weight of 398.49 g/mol. Its IUPAC name is (2S)-1-(1H-indol-3-yl)-2-phenyl-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)ethanone.
| Compound Name | (2S)-1-(1H-indol-3-yl)-2-phenyl-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 8893705 |
| Molecular Formula | C24H24N5O+ |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (2S)-1-(1H-indol-3-yl)-2-phenyl-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)ethanone |
| SMILES | O=C(c1c[nH]c2ccccc12)[C@H](c1ccccc1)[NH+]1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C24H23N5O/c30-23(20-17-27-21-10-5-4-9-19(20)21)22(18-7-2-1-3-8-18)28-13-15-29(16-14-28)24-25-11-6-12-26-24/h1-12,17,22,27H,13-16H2/p+1/t22-/m0/s1 |
| InChIKey | SLPDENLVPPBSJD-QFIPXVFZSA-O |
| XLogP | 2.29 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |