C24H27N2O3+ — CID 9356742
ethyl 1-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]piperidin-1-ium-4-carboxylate (PubChem CID 9356742) has the molecular formula C24H27N2O3+ and a molecular weight of 391.49 g/mol. Its IUPAC name is ethyl 1-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 9356742 |
| Molecular Formula | C24H27N2O3+ |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | ethyl 1-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+]([C@@H](C(=O)c2c[nH]c3ccccc23)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H26N2O3/c1-2-29-24(28)18-12-14-26(15-13-18)22(17-8-4-3-5-9-17)23(27)20-16-25-21-11-7-6-10-19(20)21/h3-11,16,18,22,25H,2,12-15H2,1H3/p+1/t22-/m1/s1 |
| InChIKey | MEZBPYUTOBSSAB-JOCHJYFZSA-O |
| XLogP | 2.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |