C11H11ClF3NO4S — CID 88925679
(2S)-3-(benzenesulfonyl)-3-chloro-2-(difluoroamino)-2-fluoropentanoic acid (PubChem CID 88925679) has the molecular formula C11H11ClF3NO4S and a molecular weight of 345.73 g/mol. Its IUPAC name is (2S)-3-(benzenesulfonyl)-3-chloro-2-(difluoroamino)-2-fluoropentanoic acid.
| Compound Name | (2S)-3-(benzenesulfonyl)-3-chloro-2-(difluoroamino)-2-fluoropentanoic acid |
|---|---|
| PubChem CID | 88925679 |
| Molecular Formula | C11H11ClF3NO4S |
| Molecular Weight | 345.73 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | (2S)-3-(benzenesulfonyl)-3-chloro-2-(difluoroamino)-2-fluoropentanoic acid |
| SMILES | CCC(Cl)([C@@](F)(C(=O)O)N(F)F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H11ClF3NO4S/c1-2-10(12,11(13,9(17)18)16(14)15)21(19,20)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,17,18)/t10?,11-/m1/s1 |
| InChIKey | BPDSCLHCBRXHOC-RRKGBCIJSA-N |
| XLogP | 2.63 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.73 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|