C13H22N2O4 — CID 88927950
methyl 4-(ethylamino)-3-[methyl(pent-4-enoyl)amino]-4-oxobutanoate (PubChem CID 88927950) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is methyl 4-(ethylamino)-3-[methyl(pent-4-enoyl)amino]-4-oxobutanoate.
| Compound Name | methyl 4-(ethylamino)-3-[methyl(pent-4-enoyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 88927950 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | methyl 4-(ethylamino)-3-[methyl(pent-4-enoyl)amino]-4-oxobutanoate |
| SMILES | C=CCCC(=O)N(C)C(CC(=O)OC)C(=O)NCC |
| InChI | InChI=1S/C13H22N2O4/c1-5-7-8-11(16)15(3)10(9-12(17)19-4)13(18)14-6-2/h5,10H,1,6-9H2,2-4H3,(H,14,18) |
| InChIKey | VSXUQFLEBQJROF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|