C15H25NO4 — CID 88928519
5-methylhexa-3,4-dien-3-yl 2-[methyl(2-methylpropoxycarbonyl)amino]acetate (PubChem CID 88928519) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 5-methylhexa-3,4-dien-3-yl 2-[methyl(2-methylpropoxycarbonyl)amino]acetate.
| Compound Name | 5-methylhexa-3,4-dien-3-yl 2-[methyl(2-methylpropoxycarbonyl)amino]acetate |
|---|---|
| PubChem CID | 88928519 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 5-methylhexa-3,4-dien-3-yl 2-[methyl(2-methylpropoxycarbonyl)amino]acetate |
| SMILES | CCC(=C=C(C)C)OC(=O)CN(C)C(=O)OCC(C)C |
| InChI | InChI=1S/C15H25NO4/c1-7-13(8-11(2)3)20-14(17)9-16(6)15(18)19-10-12(4)5/h12H,7,9-10H2,1-6H3 |
| InChIKey | FFUUWZBURHORDT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|