C24H21F3N2O3 — CID 88934886
1-methyl-2-oxo-1'-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-5-carbaldehyde (PubChem CID 88934886) has the molecular formula C24H21F3N2O3 and a molecular weight of 442.44 g/mol. Its IUPAC name is 1-methyl-2-oxo-1'-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-5-carbaldehyde.
| Compound Name | 1-methyl-2-oxo-1'-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-5-carbaldehyde |
|---|---|
| PubChem CID | 88934886 |
| Molecular Formula | C24H21F3N2O3 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1-methyl-2-oxo-1'-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-5-carbaldehyde |
| SMILES | CN1C(=O)C2(CCN(C(=O)/C=C/c3ccccc3C(F)(F)F)CC2)c2cc(C=O)ccc21 |
| InChI | InChI=1S/C24H21F3N2O3/c1-28-20-8-6-16(15-30)14-19(20)23(22(28)32)10-12-29(13-11-23)21(31)9-7-17-4-2-3-5-18(17)24(25,26)27/h2-9,14-15H,10-13H2,1H3/b9-7+ |
| InChIKey | QWFYMXVZGMZSBG-VQHVLOKHSA-N |
| XLogP | 4.07 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|