C36H47N5O4 — CID 88939413
3-[1-[1-[(2Z)-2-(aminomethylideneamino)-3-methyl-4-[[(2R,6S)-6-(4-methylphenyl)oxan-2-yl]methylamino]penta-2,4-dienoyl]piperidin-4-yl]pyrrolidin-3-yl]benzoic acid (PubChem CID 88939413) has the molecular formula C36H47N5O4 and a molecular weight of 613.80 g/mol. Its IUPAC name is 3-[1-[1-[(2Z)-2-(aminomethylideneamino)-3-methyl-4-[[(2R,6S)-6-(4-methylphenyl)oxan-2-yl]methylamino]penta-2,4-dienoyl]piperidin-4-yl]pyrrolidin-3-yl]benzoic acid.
| Compound Name | 3-[1-[1-[(2Z)-2-(aminomethylideneamino)-3-methyl-4-[[(2R,6S)-6-(4-methylphenyl)oxan-2-yl]methylamino]penta-2,4-dienoyl]piperidin-4-yl]pyrrolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 88939413 |
| Molecular Formula | C36H47N5O4 |
| Molecular Weight | 613.80 g/mol |
| Exact Mass | 613.36 |
| IUPAC Name | 3-[1-[1-[(2Z)-2-(aminomethylideneamino)-3-methyl-4-[[(2R,6S)-6-(4-methylphenyl)oxan-2-yl]methylamino]penta-2,4-dienoyl]piperidin-4-yl]pyrrolidin-3-yl]benzoic acid |
| SMILES | C=C(NC[C@H]1CCC[C@@H](c2ccc(C)cc2)O1)/C(C)=C(\N=C\N)C(=O)N1CCC(N2CCC(c3cccc(C(=O)O)c3)C2)CC1 |
| InChI | InChI=1S/C36H47N5O4/c1-24-10-12-27(13-11-24)33-9-5-8-32(45-33)21-38-26(3)25(2)34(39-23-37)35(42)40-18-15-31(16-19-40)41-17-14-30(22-41)28-6-4-7-29(20-28)36(43)44/h4,6-7,10-13,20,23,30-33,38H,3,5,8-9,14-19,21-22H2,1-2H3,(H2,37,39)(H,43,44)/b34-25-/t30?,32-,33+/m1/s1 |
| InChIKey | GHQXHOFIAWANHT-YOJKULFVSA-N |
| XLogP | 5.15 |
| TPSA | 120.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.80 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|