C26H34F3N5O3 — CID 89304795
N'-[(2Z)-1-[4-[(4aR,8aR)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl]piperidin-1-yl]-3-methyl-1-oxo-4-[3-(trifluoromethyl)anilino]penta-2,4-dien-2-yl]methanimidamide (PubChem CID 89304795) has the molecular formula C26H34F3N5O3 and a molecular weight of 521.58 g/mol. Its IUPAC name is N'-[(2Z)-1-[4-[(4aR,8aR)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl]piperidin-1-yl]-3-methyl-1-oxo-4-[3-(trifluoromethyl)anilino]penta-2,4-dien-2-yl]methanimidamide.
| Compound Name | N'-[(2Z)-1-[4-[(4aR,8aR)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl]piperidin-1-yl]-3-methyl-1-oxo-4-[3-(trifluoromethyl)anilino]penta-2,4-dien-2-yl]methanimidamide |
|---|---|
| PubChem CID | 89304795 |
| Molecular Formula | C26H34F3N5O3 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | N'-[(2Z)-1-[4-[(4aR,8aR)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl]piperidin-1-yl]-3-methyl-1-oxo-4-[3-(trifluoromethyl)anilino]penta-2,4-dien-2-yl]methanimidamide |
| SMILES | C=C(Nc1cccc(C(F)(F)F)c1)/C(C)=C(\N=C\N)C(=O)N1CCC(N2CCO[C@H]3COCC[C@H]32)CC1 |
| InChI | InChI=1S/C26H34F3N5O3/c1-17(18(2)32-20-5-3-4-19(14-20)26(27,28)29)24(31-16-30)25(35)33-9-6-21(7-10-33)34-11-13-37-23-15-36-12-8-22(23)34/h3-5,14,16,21-23,32H,2,6-13,15H2,1H3,(H2,30,31)/b24-17-/t22-,23+/m1/s1 |
| InChIKey | KPDATUOWNQTFRB-OYJRBVCMSA-N |
| XLogP | 3.37 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|