C12H20N4O4 — CID 88940230
N-[1-[2-(hydroxyamino)-2-oxoethyl]-5-methyl-2-oxopyrrolidin-3-yl]pyrrolidine-2-carboxamide (PubChem CID 88940230) has the molecular formula C12H20N4O4 and a molecular weight of 284.32 g/mol. Its IUPAC name is N-[1-[2-(hydroxyamino)-2-oxoethyl]-5-methyl-2-oxopyrrolidin-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | N-[1-[2-(hydroxyamino)-2-oxoethyl]-5-methyl-2-oxopyrrolidin-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 88940230 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-[1-[2-(hydroxyamino)-2-oxoethyl]-5-methyl-2-oxopyrrolidin-3-yl]pyrrolidine-2-carboxamide |
| SMILES | CC1CC(NC(=O)C2CCCN2)C(=O)N1CC(=O)NO |
| InChI | InChI=1S/C12H20N4O4/c1-7-5-9(12(19)16(7)6-10(17)15-20)14-11(18)8-3-2-4-13-8/h7-9,13,20H,2-6H2,1H3,(H,14,18)(H,15,17) |
| InChIKey | HWNYBURLNBAMMW-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|