C15H27N — CID 88941041
(2S,3R,4E,6Z)-5-(2-cyclopropylethyl)-3,4-dimethylocta-4,6-dien-2-amine (PubChem CID 88941041) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is (2S,3R,4E,6Z)-5-(2-cyclopropylethyl)-3,4-dimethylocta-4,6-dien-2-amine.
| Compound Name | (2S,3R,4E,6Z)-5-(2-cyclopropylethyl)-3,4-dimethylocta-4,6-dien-2-amine |
|---|---|
| PubChem CID | 88941041 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (2S,3R,4E,6Z)-5-(2-cyclopropylethyl)-3,4-dimethylocta-4,6-dien-2-amine |
| SMILES | C/C=C\C(CCC1CC1)=C(/C)[C@@H](C)[C@H](C)N |
| InChI | InChI=1S/C15H27N/c1-5-6-15(10-9-14-7-8-14)12(3)11(2)13(4)16/h5-6,11,13-14H,7-10,16H2,1-4H3/b6-5-,15-12-/t11-,13+/m1/s1 |
| InChIKey | QUFMOLPEVHKTCM-YKNXUSNISA-N |
| XLogP | 4.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|