C19H17F4NO — CID 88942129
1-benzyl-4-methyl-4-(2,3,4,6-tetrafluorophenyl)pyrrolidine-3-carbaldehyde (PubChem CID 88942129) has the molecular formula C19H17F4NO and a molecular weight of 351.34 g/mol. Its IUPAC name is 1-benzyl-4-methyl-4-(2,3,4,6-tetrafluorophenyl)pyrrolidine-3-carbaldehyde.
| Compound Name | 1-benzyl-4-methyl-4-(2,3,4,6-tetrafluorophenyl)pyrrolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 88942129 |
| Molecular Formula | C19H17F4NO |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 1-benzyl-4-methyl-4-(2,3,4,6-tetrafluorophenyl)pyrrolidine-3-carbaldehyde |
| SMILES | CC1(c2c(F)cc(F)c(F)c2F)CN(Cc2ccccc2)CC1C=O |
| InChI | InChI=1S/C19H17F4NO/c1-19(16-14(20)7-15(21)17(22)18(16)23)11-24(9-13(19)10-25)8-12-5-3-2-4-6-12/h2-7,10,13H,8-9,11H2,1H3 |
| InChIKey | KPQLJQNMNFRDEG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|