C15H19F2NO — CID 171525912
2-(1-benzyl-4,4-difluoro-5-methylpiperidin-3-yl)acetaldehyde (PubChem CID 171525912) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-(1-benzyl-4,4-difluoro-5-methylpiperidin-3-yl)acetaldehyde.
| Compound Name | 2-(1-benzyl-4,4-difluoro-5-methylpiperidin-3-yl)acetaldehyde |
|---|---|
| PubChem CID | 171525912 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-(1-benzyl-4,4-difluoro-5-methylpiperidin-3-yl)acetaldehyde |
| SMILES | CC1CN(Cc2ccccc2)CC(CC=O)C1(F)F |
| InChI | InChI=1S/C15H19F2NO/c1-12-9-18(10-13-5-3-2-4-6-13)11-14(7-8-19)15(12,16)17/h2-6,8,12,14H,7,9-11H2,1H3 |
| InChIKey | FRGTYWYNRZOREW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|