C9H17OP — CID 88942450
trans-(1R,2S)-1-phosphoroso-2-propan-2-ylcyclohexane (PubChem CID 88942450) has the molecular formula C9H17OP and a molecular weight of 172.21 g/mol. Its IUPAC name is trans-(1R,2S)-1-phosphoroso-2-propan-2-ylcyclohexane.
| Compound Name | trans-(1R,2S)-1-phosphoroso-2-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 88942450 |
| Molecular Formula | C9H17OP |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | trans-(1R,2S)-1-phosphoroso-2-propan-2-ylcyclohexane |
| SMILES | CC(C)[C@@H]1CCCC[C@H]1P=O |
| InChI | InChI=1S/C9H17OP/c1-7(2)8-5-3-4-6-9(8)11-10/h7-9H,3-6H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | BZONJCMKUIMPTF-DTWKUNHWSA-N |
| XLogP | 3.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|