C20H14N2O4 — CID 8894462
[4-(1,3,4-oxadiazol-2-yl)phenyl] 2-naphthalen-1-yloxyacetate (PubChem CID 8894462) has the molecular formula C20H14N2O4 and a molecular weight of 346.34 g/mol. Its IUPAC name is [4-(1,3,4-oxadiazol-2-yl)phenyl] 2-naphthalen-1-yloxyacetate.
| Compound Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] 2-naphthalen-1-yloxyacetate |
|---|---|
| PubChem CID | 8894462 |
| Molecular Formula | C20H14N2O4 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] 2-naphthalen-1-yloxyacetate |
| SMILES | O=C(COc1cccc2ccccc12)Oc1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C20H14N2O4/c23-19(12-24-18-7-3-5-14-4-1-2-6-17(14)18)26-16-10-8-15(9-11-16)20-22-21-13-25-20/h1-11,13H,12H2 |
| InChIKey | QTQAZOWPGQQSAG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|