C16H11ClN2O4 — CID 8874039
[4-(1,3,4-oxadiazol-2-yl)phenyl] 2-(2-chlorophenoxy)acetate (PubChem CID 8874039) has the molecular formula C16H11ClN2O4 and a molecular weight of 330.73 g/mol. Its IUPAC name is [4-(1,3,4-oxadiazol-2-yl)phenyl] 2-(2-chlorophenoxy)acetate.
| Compound Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] 2-(2-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 8874039 |
| Molecular Formula | C16H11ClN2O4 |
| Molecular Weight | 330.73 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] 2-(2-chlorophenoxy)acetate |
| SMILES | O=C(COc1ccccc1Cl)Oc1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C16H11ClN2O4/c17-13-3-1-2-4-14(13)21-9-15(20)23-12-7-5-11(6-8-12)16-19-18-10-22-16/h1-8,10H,9H2 |
| InChIKey | YFWAYRGXKHPHHE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.73 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|