C21H15N3O3 — CID 1178331
[4-(1,3,4-oxadiazol-2-yl)phenyl] N,N-diphenylcarbamate (PubChem CID 1178331) has the molecular formula C21H15N3O3 and a molecular weight of 357.37 g/mol. Its IUPAC name is [4-(1,3,4-oxadiazol-2-yl)phenyl] N,N-diphenylcarbamate.
| Compound Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 1178331 |
| Molecular Formula | C21H15N3O3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] N,N-diphenylcarbamate |
| SMILES | O=C(Oc1ccc(-c2nnco2)cc1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15N3O3/c25-21(27-19-13-11-16(12-14-19)20-23-22-15-26-20)24(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-15H |
| InChIKey | GEHDECVGTLMHRD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |