C13H7BrN2O4 — CID 18077233
[4-(1,3,4-oxadiazol-2-yl)phenyl] 5-bromofuran-2-carboxylate (PubChem CID 18077233) has the molecular formula C13H7BrN2O4 and a molecular weight of 335.11 g/mol. Its IUPAC name is [4-(1,3,4-oxadiazol-2-yl)phenyl] 5-bromofuran-2-carboxylate.
| Compound Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 18077233 |
| Molecular Formula | C13H7BrN2O4 |
| Molecular Weight | 335.11 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | [4-(1,3,4-oxadiazol-2-yl)phenyl] 5-bromofuran-2-carboxylate |
| SMILES | O=C(Oc1ccc(-c2nnco2)cc1)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H7BrN2O4/c14-11-6-5-10(20-11)13(17)19-9-3-1-8(2-4-9)12-16-15-7-18-12/h1-7H |
| InChIKey | HWOKSFIAQZBOJL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.11 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|