methyl 2-[2-chloro-4-(1,3,4-oxadiazol-2-yl)phenoxy]acetate

C11H9ClN2O4 — CID 117063330

IUPACmethyl 2-[2-chloro-4-(1,3,4-oxadiazol-2-yl)phenoxy]acetate
SMILESCOC(=O)COc1ccc(-c2nnco2)cc1Cl
InChIInChI=1S/C11H9ClN2O4/c1-16-10(15)5-17-9-3-2-7(4-8(9)12)11-14-13-6-18-11/h2-4,6H,5H2,1H3
InChIKeySBKUGJCALIPFJZ-UHFFFAOYSA-N
MW268.66 g/mol
LogP1.94
Rot. Bonds4

About methyl 2-[2-chloro-4-(1,3,4-oxadiazol-2-yl)phenoxy]acetate

methyl 2-[2-chloro-4-(1,3,4-oxadiazol-2-yl)phenoxy]acetate (PubChem CID 117063330) has the molecular formula C11H9ClN2O4 and a molecular weight of 268.66 g/mol. Its IUPAC name is methyl 2-[2-chloro-4-(1,3,4-oxadiazol-2-yl)phenoxy]acetate.

Molecular Properties

Compound Namemethyl 2-[2-chloro-4-(1,3,4-oxadiazol-2-yl)phenoxy]acetate
PubChem CID117063330
Molecular FormulaC11H9ClN2O4
Molecular Weight268.66 g/mol
Exact Mass268.03
IUPAC Namemethyl 2-[2-chloro-4-(1,3,4-oxadiazol-2-yl)phenoxy]acetate
SMILESCOC(=O)COc1ccc(-c2nnco2)cc1Cl
InChIInChI=1S/C11H9ClN2O4/c1-16-10(15)5-17-9-3-2-7(4-8(9)12)11-14-13-6-18-11/h2-4,6H,5H2,1H3
InChIKeySBKUGJCALIPFJZ-UHFFFAOYSA-N
XLogP1.94
TPSA74.45 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.66
LogP ≤ 51.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 2-[2-chloro-4-(1,3,4-oxadiazol-2-yl)phenoxy]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[2-chloro-4-(1,3,4-oxadiazol-2-yl)phenoxy]acetate?
The IUPAC name of methyl 2-[2-chloro-4-(1,3,4-oxadiazol-2-yl)phenoxy]acetate (CID 117063330) is methyl 2-[2-chloro-4-(1,3,4-oxadiazol-2-yl)phenoxy]acetate.
What is the SMILES notation for methyl 2-[2-chloro-4-(1,3,4-oxadiazol-2-yl)phenoxy]acetate?
The canonical SMILES for methyl 2-[2-chloro-4-(1,3,4-oxadiazol-2-yl)phenoxy]acetate is COC(=O)COc1ccc(-c2nnco2)cc1Cl.
What is the InChIKey of methyl 2-[2-chloro-4-(1,3,4-oxadiazol-2-yl)phenoxy]acetate?
The InChIKey is SBKUGJCALIPFJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN2O4/c1-16-10(15)5-17-9-3-2-7(4-8(9)12)11-14-13-6-18-11/h2-4,6H,5H2,1H3.
What are the key properties of methyl 2-[2-chloro-4-(1,3,4-oxadiazol-2-yl)phenoxy]acetate?
methyl 2-[2-chloro-4-(1,3,4-oxadiazol-2-yl)phenoxy]acetate has a molecular weight of 268.66 g/mol, XLogP of 1.94, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-chloro-4-(1,3,4-oxadiazol-2-yl)phenoxy]acetate is sourced from PubChem (CID 117063330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).