About CID 88945224
CID 88945224 (PubChem CID 88945224) has the molecular formula C14H24B4O7P
and a molecular weight of 378.56 g/mol.
Molecular Properties
| Compound Name | CID 88945224 |
| PubChem CID | 88945224 |
| Molecular Formula | C14H24B4O7P |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | — |
| SMILES | [B][B][C@@H]1O[C@H](COP([B])(=O)OC2[C@H]([B])O[C@H](COC)[C@@H]2C)[C@H](OC)C1C |
| InChI | InChI=1S/C14H24B4O7P/c1-7-9(5-20-3)23-13(15)12(7)25-26(17,19)22-6-10-11(21-4)8(2)14(18-16)24-10/h7-14H,5-6H2,1-4H3/t7-,8?,9+,10+,11+,12?,13+,14+,26?/m0/s1 |
| InChIKey | FJRFVYLYLDHVPL-FQVUIVRDSA-N |
| XLogP | 0.00 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 88945224 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88945224?
The IUPAC name of CID 88945224 (CID 88945224) is not available.
What is the SMILES notation for CID 88945224?
The canonical SMILES for CID 88945224 is [B][B][C@@H]1O[C@H](COP([B])(=O)OC2[C@H]([B])O[C@H](COC)[C@@H]2C)[C@H](OC)C1C.
What is the InChIKey of CID 88945224?
The InChIKey is FJRFVYLYLDHVPL-FQVUIVRDSA-N. The full InChI is InChI=1S/C14H24B4O7P/c1-7-9(5-20-3)23-13(15)12(7)25-26(17,19)22-6-10-11(21-4)8(2)14(18-16)24-10/h7-14H,5-6H2,1-4H3/t7-,8?,9+,10+,11+,12?,13+,14+,26?/m0/s1.
What are the key properties of CID 88945224?
CID 88945224 has a molecular weight of 378.56 g/mol, XLogP of 0.00, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88945224 is sourced from PubChem (CID 88945224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).