C21H28FN4OS+ — CID 8894817
diethyl-[[4-[2-(2-fluorophenoxy)ethylamino]-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]azanium (PubChem CID 8894817) has the molecular formula C21H28FN4OS+ and a molecular weight of 403.55 g/mol. Its IUPAC name is diethyl-[[4-[2-(2-fluorophenoxy)ethylamino]-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]azanium.
| Compound Name | diethyl-[[4-[2-(2-fluorophenoxy)ethylamino]-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 8894817 |
| Molecular Formula | C21H28FN4OS+ |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | diethyl-[[4-[2-(2-fluorophenoxy)ethylamino]-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]azanium |
| SMILES | CC[NH+](CC)Cc1nc(NCCOc2ccccc2F)c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C21H27FN4OS/c1-5-26(6-2)13-18-24-20(19-14(3)15(4)28-21(19)25-18)23-11-12-27-17-10-8-7-9-16(17)22/h7-10H,5-6,11-13H2,1-4H3,(H,23,24,25)/p+1 |
| InChIKey | TVPKAXCVZUSKKS-UHFFFAOYSA-O |
| XLogP | 3.36 |
| TPSA | 51.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|