C34H33BN2O5S2 — CID 88948929
CID 88948929 (PubChem CID 88948929) has the molecular formula C34H33BN2O5S2 and a molecular weight of 624.59 g/mol.
| Compound Name | CID 88948929 |
|---|---|
| PubChem CID | 88948929 |
| Molecular Formula | C34H33BN2O5S2 |
| Molecular Weight | 624.59 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C2CC(O)=C3CN(S(=O)(=O)c4ccc(C)cc4)C(c4ccccc4)C[C@@H]3N2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C34H33BN2O5S2/c1-23-8-16-28(17-9-23)43(39,40)36-22-30-33(20-31(36)25-6-4-3-5-7-25)37(44(41,42)29-18-10-24(2)11-19-29)32(21-34(30)38)26-12-14-27(35)15-13-26/h3-19,31-33,38H,20-22H2,1-2H3/t31?,32?,33-/m0/s1 |
| InChIKey | HRTUCEMPTHTGDV-PJUZOBRJSA-N |
| XLogP | 5.25 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|