C13H25NO2 — CID 88949774
3-cyclobutyl-N-methoxy-N,2,2,3-tetramethylbutanamide (PubChem CID 88949774) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 3-cyclobutyl-N-methoxy-N,2,2,3-tetramethylbutanamide.
| Compound Name | 3-cyclobutyl-N-methoxy-N,2,2,3-tetramethylbutanamide |
|---|---|
| PubChem CID | 88949774 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 3-cyclobutyl-N-methoxy-N,2,2,3-tetramethylbutanamide |
| SMILES | CON(C)C(=O)C(C)(C)C(C)(C)C1CCC1 |
| InChI | InChI=1S/C13H25NO2/c1-12(2,10-8-7-9-10)13(3,4)11(15)14(5)16-6/h10H,7-9H2,1-6H3 |
| InChIKey | ATAWBZGDCQSMTP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|