C10H22N2O6 — CID 88950690
(2R)-2-amino-2-(hydroxymethyl)butanoic acid;ethyl (2R)-2-amino-3-hydroxypropanoate (PubChem CID 88950690) has the molecular formula C10H22N2O6 and a molecular weight of 266.29 g/mol. Its IUPAC name is (2R)-2-amino-2-(hydroxymethyl)butanoic acid;ethyl (2R)-2-amino-3-hydroxypropanoate.
| Compound Name | (2R)-2-amino-2-(hydroxymethyl)butanoic acid;ethyl (2R)-2-amino-3-hydroxypropanoate |
|---|---|
| PubChem CID | 88950690 |
| Molecular Formula | C10H22N2O6 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (2R)-2-amino-2-(hydroxymethyl)butanoic acid;ethyl (2R)-2-amino-3-hydroxypropanoate |
| SMILES | CCOC(=O)[C@H](N)CO.CC[C@@](N)(CO)C(=O)O |
| InChI | InChI=1S/2C5H11NO3/c1-2-5(6,3-7)4(8)9;1-2-9-5(8)4(6)3-7/h7H,2-3,6H2,1H3,(H,8,9);4,7H,2-3,6H2,1H3/t5-;4-/m11/s1 |
| InChIKey | CWZSIYJYTABVSF-ZYTCOCFOSA-N |
| XLogP | -1.96 |
| TPSA | 156.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |