C11H19NO2 — CID 88953843
(3E)-6-(3-methoxyprop-1-en-2-ylamino)-4-methylhexa-1,3-dien-2-ol (PubChem CID 88953843) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (3E)-6-(3-methoxyprop-1-en-2-ylamino)-4-methylhexa-1,3-dien-2-ol.
| Compound Name | (3E)-6-(3-methoxyprop-1-en-2-ylamino)-4-methylhexa-1,3-dien-2-ol |
|---|---|
| PubChem CID | 88953843 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (3E)-6-(3-methoxyprop-1-en-2-ylamino)-4-methylhexa-1,3-dien-2-ol |
| SMILES | C=C(O)/C=C(\C)CCNC(=C)COC |
| InChI | InChI=1S/C11H19NO2/c1-9(7-11(3)13)5-6-12-10(2)8-14-4/h7,12-13H,2-3,5-6,8H2,1,4H3/b9-7+ |
| InChIKey | WHCVWHZETHGEKZ-VQHVLOKHSA-N |
| XLogP | 2.14 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|