C6H14N2 — CID 88957050
2-ethylimino-N,N-dimethylethanamine (PubChem CID 88957050) has the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. Its IUPAC name is 2-ethylimino-N,N-dimethylethanamine.
| Compound Name | 2-ethylimino-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 88957050 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | 2-ethylimino-N,N-dimethylethanamine |
| SMILES | CC/N=C/CN(C)C |
| InChI | InChI=1S/C6H14N2/c1-4-7-5-6-8(2)3/h5H,4,6H2,1-3H3/b7-5+ |
| InChIKey | NRHDFKKKLIQVGJ-FNORWQNLSA-N |
| XLogP | 0.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|