About 2-ethylimino-N,N-dimethylethanamine
2-ethylimino-N,N-dimethylethanamine (PubChem CID 88957050) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is 2-ethylimino-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-ethylimino-N,N-dimethylethanamine |
| PubChem CID | 88957050 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | 2-ethylimino-N,N-dimethylethanamine |
| SMILES | CC/N=C/CN(C)C |
| InChI | InChI=1S/C6H14N2/c1-4-7-5-6-8(2)3/h5H,4,6H2,1-3H3/b7-5+ |
| InChIKey | NRHDFKKKLIQVGJ-FNORWQNLSA-N |
| XLogP | 0.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylimino-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylimino-N,N-dimethylethanamine?
The IUPAC name of 2-ethylimino-N,N-dimethylethanamine (CID 88957050) is 2-ethylimino-N,N-dimethylethanamine.
What is the SMILES notation for 2-ethylimino-N,N-dimethylethanamine?
The canonical SMILES for 2-ethylimino-N,N-dimethylethanamine is CC/N=C/CN(C)C.
What is the InChIKey of 2-ethylimino-N,N-dimethylethanamine?
The InChIKey is NRHDFKKKLIQVGJ-FNORWQNLSA-N. The full InChI is InChI=1S/C6H14N2/c1-4-7-5-6-8(2)3/h5H,4,6H2,1-3H3/b7-5+.
What are the key properties of 2-ethylimino-N,N-dimethylethanamine?
2-ethylimino-N,N-dimethylethanamine has a molecular weight of 114.19 g/mol, XLogP of 0.64, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylimino-N,N-dimethylethanamine is sourced from PubChem (CID 88957050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).