C39H33N3O2S — CID 88957100
5-[[6-[3,4-dihydronaphthalen-2-yl(naphthalen-2-yl)amino]naphthalen-2-yl]methylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 88957100) has the molecular formula C39H33N3O2S and a molecular weight of 607.78 g/mol. Its IUPAC name is 5-[[6-[3,4-dihydronaphthalen-2-yl(naphthalen-2-yl)amino]naphthalen-2-yl]methylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[6-[3,4-dihydronaphthalen-2-yl(naphthalen-2-yl)amino]naphthalen-2-yl]methylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 88957100 |
| Molecular Formula | C39H33N3O2S |
| Molecular Weight | 607.78 g/mol |
| Exact Mass | 607.23 |
| IUPAC Name | 5-[[6-[3,4-dihydronaphthalen-2-yl(naphthalen-2-yl)amino]naphthalen-2-yl]methylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN1C(=O)C(=Cc2ccc3cc(N(C4=Cc5ccccc5CC4)c4ccc5ccccc5c4)ccc3c2)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C39H33N3O2S/c1-3-40-37(43)36(38(44)41(4-2)39(40)45)22-26-13-14-32-25-35(20-17-31(32)21-26)42(33-18-15-27-9-5-7-11-29(27)23-33)34-19-16-28-10-6-8-12-30(28)24-34/h5-15,17-18,20-25H,3-4,16,19H2,1-2H3 |
| InChIKey | QJNMBSDZYBCPRB-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.78 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|