C28H28BClF2N4O4 — CID 88958699
CID 88958699 (PubChem CID 88958699) has the molecular formula C28H28BClF2N4O4 and a molecular weight of 568.82 g/mol.
| Compound Name | CID 88958699 |
|---|---|
| PubChem CID | 88958699 |
| Molecular Formula | C28H28BClF2N4O4 |
| Molecular Weight | 568.82 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(NC(=O)c2cc(NC(=O)c3cc(CNC(=O)C(C)(C)NC)ccc3Cl)ccc2OCC(F)F)cc1 |
| InChI | InChI=1S/C28H28BClF2N4O4/c1-28(2,33-3)27(39)34-14-16-4-10-22(30)20(12-16)25(37)36-19-9-11-23(40-15-24(31)32)21(13-19)26(38)35-18-7-5-17(29)6-8-18/h4-13,24,33H,14-15H2,1-3H3,(H,34,39)(H,35,38)(H,36,37) |
| InChIKey | CRFAGSATJBLTCR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.82 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|