C30H25Cl3F5NO4 — CID 58483269
5-[2-[2-chloro-5-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-N-(3,4-dichlorophenyl)-2-(2,2-difluoroethoxy)benzamide (PubChem CID 58483269) has the molecular formula C30H25Cl3F5NO4 and a molecular weight of 664.88 g/mol. Its IUPAC name is 5-[2-[2-chloro-5-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-N-(3,4-dichlorophenyl)-2-(2,2-difluoroethoxy)benzamide.
| Compound Name | 5-[2-[2-chloro-5-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-N-(3,4-dichlorophenyl)-2-(2,2-difluoroethoxy)benzamide |
|---|---|
| PubChem CID | 58483269 |
| Molecular Formula | C30H25Cl3F5NO4 |
| Molecular Weight | 664.88 g/mol |
| Exact Mass | 663.08 |
| IUPAC Name | 5-[2-[2-chloro-5-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-N-(3,4-dichlorophenyl)-2-(2,2-difluoroethoxy)benzamide |
| SMILES | CC(C)(C(=O)CCc1ccc(Cl)c(C(=O)Cc2ccc(OCC(F)F)c(C(=O)Nc3ccc(Cl)c(Cl)c3)c2)c1)C(F)(F)F |
| InChI | InChI=1S/C30H25Cl3F5NO4/c1-29(2,30(36,37)38)26(41)10-5-16-3-7-21(31)19(11-16)24(40)13-17-4-9-25(43-15-27(34)35)20(12-17)28(42)39-18-6-8-22(32)23(33)14-18/h3-4,6-9,11-12,14,27H,5,10,13,15H2,1-2H3,(H,39,42) |
| InChIKey | PIFGDKPVMWFUBI-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.88 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |