C27H24ClF10NO4 — CID 58483264
5-[2-[2-chloro-5-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-2-(2,2-difluoroethoxy)-N-(2,2,3,3,3-pentafluoropropyl)benzamide (PubChem CID 58483264) has the molecular formula C27H24ClF10NO4 and a molecular weight of 651.93 g/mol. Its IUPAC name is 5-[2-[2-chloro-5-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-2-(2,2-difluoroethoxy)-N-(2,2,3,3,3-pentafluoropropyl)benzamide.
| Compound Name | 5-[2-[2-chloro-5-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-2-(2,2-difluoroethoxy)-N-(2,2,3,3,3-pentafluoropropyl)benzamide |
|---|---|
| PubChem CID | 58483264 |
| Molecular Formula | C27H24ClF10NO4 |
| Molecular Weight | 651.93 g/mol |
| Exact Mass | 651.12 |
| IUPAC Name | 5-[2-[2-chloro-5-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-2-(2,2-difluoroethoxy)-N-(2,2,3,3,3-pentafluoropropyl)benzamide |
| SMILES | CC(C)(C(=O)CCc1ccc(Cl)c(C(=O)Cc2ccc(OCC(F)F)c(C(=O)NCC(F)(F)C(F)(F)F)c2)c1)C(F)(F)F |
| InChI | InChI=1S/C27H24ClF10NO4/c1-24(2,26(33,34)35)21(41)8-5-14-3-6-18(28)16(9-14)19(40)11-15-4-7-20(43-12-22(29)30)17(10-15)23(42)39-13-25(31,32)27(36,37)38/h3-4,6-7,9-10,22H,5,8,11-13H2,1-2H3,(H,39,42) |
| InChIKey | ZYIKUJSOYHRNNF-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.93 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|