C29H25Cl2F5N2O4 — CID 58483388
N-(3-chloro-4-pyridinyl)-5-[2-[2-chloro-5-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-2-(2,2-difluoroethoxy)benzamide (PubChem CID 58483388) has the molecular formula C29H25Cl2F5N2O4 and a molecular weight of 631.43 g/mol. Its IUPAC name is N-(3-chloro-4-pyridinyl)-5-[2-[2-chloro-5-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-2-(2,2-difluoroethoxy)benzamide.
| Compound Name | N-(3-chloro-4-pyridinyl)-5-[2-[2-chloro-5-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-2-(2,2-difluoroethoxy)benzamide |
|---|---|
| PubChem CID | 58483388 |
| Molecular Formula | C29H25Cl2F5N2O4 |
| Molecular Weight | 631.43 g/mol |
| Exact Mass | 630.11 |
| IUPAC Name | N-(3-chloro-4-pyridinyl)-5-[2-[2-chloro-5-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-2-(2,2-difluoroethoxy)benzamide |
| SMILES | CC(C)(C(=O)CCc1ccc(Cl)c(C(=O)Cc2ccc(OCC(F)F)c(C(=O)Nc3ccncc3Cl)c2)c1)C(F)(F)F |
| InChI | InChI=1S/C29H25Cl2F5N2O4/c1-28(2,29(34,35)36)25(40)8-5-16-3-6-20(30)18(11-16)23(39)13-17-4-7-24(42-15-26(32)33)19(12-17)27(41)38-22-9-10-37-14-21(22)31/h3-4,6-7,9-12,14,26H,5,8,13,15H2,1-2H3,(H,37,38,41) |
| InChIKey | QNSHFLYFFMRLDT-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.43 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |