C31H27Cl3F5NO5 — CID 58483438
N-(4-chloro-2-methoxyphenyl)-5-[2-[2,6-dichloro-3-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-2-(2,2-difluoroethoxy)benzamide (PubChem CID 58483438) has the molecular formula C31H27Cl3F5NO5 and a molecular weight of 694.91 g/mol. Its IUPAC name is N-(4-chloro-2-methoxyphenyl)-5-[2-[2,6-dichloro-3-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-2-(2,2-difluoroethoxy)benzamide.
| Compound Name | N-(4-chloro-2-methoxyphenyl)-5-[2-[2,6-dichloro-3-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-2-(2,2-difluoroethoxy)benzamide |
|---|---|
| PubChem CID | 58483438 |
| Molecular Formula | C31H27Cl3F5NO5 |
| Molecular Weight | 694.91 g/mol |
| Exact Mass | 693.09 |
| IUPAC Name | N-(4-chloro-2-methoxyphenyl)-5-[2-[2,6-dichloro-3-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-2-(2,2-difluoroethoxy)benzamide |
| SMILES | COc1cc(Cl)ccc1NC(=O)c1cc(CC(=O)c2c(Cl)ccc(CCC(=O)C(C)(C)C(F)(F)F)c2Cl)ccc1OCC(F)F |
| InChI | InChI=1S/C31H27Cl3F5NO5/c1-30(2,31(37,38)39)25(42)11-6-17-5-8-20(33)27(28(17)34)22(41)13-16-4-10-23(45-15-26(35)36)19(12-16)29(43)40-21-9-7-18(32)14-24(21)44-3/h4-5,7-10,12,14,26H,6,11,13,15H2,1-3H3,(H,40,43) |
| InChIKey | UXPCIZNKNHKFEI-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.91 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |