C27H25Cl2F8NO4 — CID 58483404
5-[2-[2,6-dichloro-3-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-2-(2,2-difluoroethoxy)-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 58483404) has the molecular formula C27H25Cl2F8NO4 and a molecular weight of 650.39 g/mol. Its IUPAC name is 5-[2-[2,6-dichloro-3-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-2-(2,2-difluoroethoxy)-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | 5-[2-[2,6-dichloro-3-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-2-(2,2-difluoroethoxy)-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 58483404 |
| Molecular Formula | C27H25Cl2F8NO4 |
| Molecular Weight | 650.39 g/mol |
| Exact Mass | 649.10 |
| IUPAC Name | 5-[2-[2,6-dichloro-3-(5,5,5-trifluoro-4,4-dimethyl-3-oxopentyl)phenyl]-2-oxoethyl]-2-(2,2-difluoroethoxy)-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | CC(C)(C(=O)CCc1ccc(Cl)c(C(=O)Cc2ccc(OCC(F)F)c(C(=O)NCCC(F)(F)F)c2)c1Cl)C(F)(F)F |
| InChI | InChI=1S/C27H25Cl2F8NO4/c1-25(2,27(35,36)37)20(40)8-5-15-4-6-17(28)22(23(15)29)18(39)12-14-3-7-19(42-13-21(30)31)16(11-14)24(41)38-10-9-26(32,33)34/h3-4,6-7,11,21H,5,8-10,12-13H2,1-2H3,(H,38,41) |
| InChIKey | DKODNJJHXBKAJR-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.39 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |