C28H27BClF2N3O5 — CID 88958750
CID 88958750 (PubChem CID 88958750) has the molecular formula C28H27BClF2N3O5 and a molecular weight of 569.80 g/mol.
| Compound Name | CID 88958750 |
|---|---|
| PubChem CID | 88958750 |
| Molecular Formula | C28H27BClF2N3O5 |
| Molecular Weight | 569.80 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(NC(=O)c2cc(NC(=O)c3cc(CNC(=O)C(C)(C)OC)ccc3Cl)ccc2OCC(F)F)cc1 |
| InChI | InChI=1S/C28H27BClF2N3O5/c1-28(2,39-3)27(38)33-14-16-4-10-22(30)20(12-16)25(36)35-19-9-11-23(40-15-24(31)32)21(13-19)26(37)34-18-7-5-17(29)6-8-18/h4-13,24H,14-15H2,1-3H3,(H,33,38)(H,34,37)(H,35,36) |
| InChIKey | KLIWSWSMSBYBQN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.80 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|