C29H40N6O7S — CID 88960532
(4aS,5aS,12aR)-5a-amino-9-[[2-(tert-butylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11-trihydroxy-3,12-dioxo-12a-sulfanyl-4,4a,5,6-tetrahydrotetracene-2-carboxamide (PubChem CID 88960532) has the molecular formula C29H40N6O7S and a molecular weight of 616.74 g/mol. Its IUPAC name is (4aS,5aS,12aR)-5a-amino-9-[[2-(tert-butylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11-trihydroxy-3,12-dioxo-12a-sulfanyl-4,4a,5,6-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aS,12aR)-5a-amino-9-[[2-(tert-butylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11-trihydroxy-3,12-dioxo-12a-sulfanyl-4,4a,5,6-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 88960532 |
| Molecular Formula | C29H40N6O7S |
| Molecular Weight | 616.74 g/mol |
| Exact Mass | 616.27 |
| IUPAC Name | (4aS,5aS,12aR)-5a-amino-9-[[2-(tert-butylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11-trihydroxy-3,12-dioxo-12a-sulfanyl-4,4a,5,6-tetrahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NC(=O)CNC(C)(C)C)c(O)c2c1C[C@@]1(N)C[C@H]3C(N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(S)C(=O)C1=C2O |
| InChI | InChI=1S/C29H40N6O7S/c1-27(2,3)32-11-16(36)33-14-8-15(34(4)5)12-9-28(31)10-13-20(35(6)7)23(39)18(26(30)42)24(40)29(13,43)25(41)19(28)22(38)17(12)21(14)37/h8,13,20,32,37-38,40,43H,9-11,31H2,1-7H3,(H2,30,42)(H,33,36)/t13-,20?,28+,29+/m0/s1 |
| InChIKey | NUYZXDQOWAUHJH-NLTJSQTJSA-N |
| XLogP | 0.38 |
| TPSA | 211.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.74 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|