C28H35N5O7 — CID 89490099
(4S,4aS,5aS,12aR)-5a-amino-4,7-bis(dimethylamino)-9-[3-(dimethylamino)prop-1-ynyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4,4a,5,6-tetrahydrotetracene-2-carboxamide (PubChem CID 89490099) has the molecular formula C28H35N5O7 and a molecular weight of 553.62 g/mol. Its IUPAC name is (4S,4aS,5aS,12aR)-5a-amino-4,7-bis(dimethylamino)-9-[3-(dimethylamino)prop-1-ynyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4,4a,5,6-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,12aR)-5a-amino-4,7-bis(dimethylamino)-9-[3-(dimethylamino)prop-1-ynyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4,4a,5,6-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 89490099 |
| Molecular Formula | C28H35N5O7 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | (4S,4aS,5aS,12aR)-5a-amino-4,7-bis(dimethylamino)-9-[3-(dimethylamino)prop-1-ynyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4,4a,5,6-tetrahydrotetracene-2-carboxamide |
| SMILES | CN(C)CC#Cc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@]1(N)C2 |
| InChI | InChI=1S/C28H35N5O7/c1-31(2)9-7-8-13-10-16(32(3)4)14-11-27(30)12-15-20(33(5)6)23(36)18(26(29)39)24(37)28(15,40)25(38)19(27)22(35)17(14)21(13)34/h10,15,20,34-35,37,40H,9,11-12,30H2,1-6H3,(H2,29,39)/t15-,20-,27+,28+/m0/s1 |
| InChIKey | WJHITBKFLMHQOD-YVCCCKDYSA-N |
| XLogP | -0.98 |
| TPSA | 193.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|