C25H27N5O7 — CID 138512146
(4S,4aS,5aS,12aR)-5a-amino-4,7-bis(dimethylamino)-9-ethynyl-1,11,12a-trihydroxy-10-nitroso-3,12-dioxo-4,4a,5,6-tetrahydrotetracene-2-carboxamide (PubChem CID 138512146) has the molecular formula C25H27N5O7 and a molecular weight of 509.52 g/mol. Its IUPAC name is (4S,4aS,5aS,12aR)-5a-amino-4,7-bis(dimethylamino)-9-ethynyl-1,11,12a-trihydroxy-10-nitroso-3,12-dioxo-4,4a,5,6-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,12aR)-5a-amino-4,7-bis(dimethylamino)-9-ethynyl-1,11,12a-trihydroxy-10-nitroso-3,12-dioxo-4,4a,5,6-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 138512146 |
| Molecular Formula | C25H27N5O7 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | (4S,4aS,5aS,12aR)-5a-amino-4,7-bis(dimethylamino)-9-ethynyl-1,11,12a-trihydroxy-10-nitroso-3,12-dioxo-4,4a,5,6-tetrahydrotetracene-2-carboxamide |
| SMILES | C#Cc1cc(N(C)C)c2c(c1N=O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@]1(N)C2 |
| InChI | InChI=1S/C25H27N5O7/c1-6-10-7-13(29(2)3)11-8-24(27)9-12-18(30(4)5)20(32)15(23(26)35)21(33)25(12,36)22(34)16(24)19(31)14(11)17(10)28-37/h1,7,12,18,31,33,36H,8-9,27H2,2-5H3,(H2,26,35)/t12-,18-,24+,25+/m0/s1 |
| InChIKey | DDRNIZOVAQQEDB-CINGNFQGSA-N |
| XLogP | -0.22 |
| TPSA | 199.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|